9JR
4-azanyl-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one
Find entries where: 9JR
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 4-azanyl-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| Identifiers | 4-azanyl-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| Formula | C22 H30 N6 O2 |
| Molecular Weight | 410.513 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCCCOc1nc(c2c(n1)N(CC(=O)N2)Cc3cccc(c3)CN4CCCC4)N |
| InChI | InChI=1S/C22H30N6O2/c1-2-3-11-30-22-25-20(23)19-21(26-22)28(15-18(29)24-19)14-17-8-6-7-16(12-17)13-27-9-4-5-10-27/h6-8,12H,2-5,9-11,13-15H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | VFOKSTCIRGDTBR-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 60 |
| Chiral Atom Count | 0 |
| Bond Count | 63 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12687 |
|---|---|
| Name | Vesatolimod |
| Groups | investigational |
| Description | Vesatolimod has been used in trials studying the treatment of Hepatitis B and Chronic Hepatitis B. |
| Synonyms | Vesatolimod |
| Categories |
|
| CAS number | 1228585-88-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2424780 |
| PubChem | 46241268 |
| ChEMBL | CHEMBL2424780 |
