GHE
(2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxidanylidene-hexanoyl]pyrrolidine-2-carboxylic acid
Find entries where: GHE
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxidanylidene-hexanoyl]pyrrolidine-2-carboxylic acid |
| Identifiers | (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxidanylidene-hexanoyl]pyrrolidine-2-carboxylic acid |
| Formula | C16 H24 N2 O6 |
| Molecular Weight | 340.372 |
| Type | NON-POLYMER |
| Isomeric SMILES | C1C[C@@H](N(C1)C(=O)CCCCC(=O)N2CCC[C@@H]2C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N2O6/c19-13(17-9-3-5-11(17)15(21)22)7-1-2-8-14(20)18-10-4-6-12(18)16(23)24/h11-12H,1-10H2,(H,21,22)(H,23,24)/t11-,12-/m1/s1 |
| InChIKey | HZLAWYIBLZNRFZ-VXGBXAGGSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 48 |
| Chiral Atom Count | 2 |
| Bond Count | 49 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB13087 |
|---|---|
| Name | Miridesap |
| Groups | investigational |
| Description | Miridesap has been used in trials studying the prevention of HIV and treatment of AL amyloidosis. |
| Synonyms |
|
| CAS number | 224624-80-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 125516 |
| ChEMBL | CHEMBL25263 |
