ICD
4-hydroxy-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide
Find entries where: ICD
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 4-hydroxy-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
| Synonyms | Isoxicam |
| Identifiers | (2S)-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)-4-oxidanyl-1,1-bis(oxidanylidene)-1$l^{6},2-benzothiazine-3-carboxamide |
| Formula | C14 H13 N3 O5 S |
| Molecular Weight | 335.335 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1cc(no1)NC(=O)C2=C(c3ccccc3S(=O)(=O)[N@]2C)O |
| InChI | InChI=1S/C14H13N3O5S/c1-8-7-11(16-22-8)15-14(19)12-13(18)9-5-3-4-6-10(9)23(20,21)17(12)2/h3-7,18H,1-2H3,(H,15,16,19) |
| InChIKey | YYUAYBYLJSNDCX-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 36 |
| Chiral Atom Count | 0 |
| Bond Count | 38 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB08942 |
|---|---|
| Name | Isoxicam |
| Groups |
|
| Description | Isoxicam is a non-steroidal anti-inflammatory drug that is not marketed in the United States. |
| Synonyms |
|
| Categories |
|
| CAS number | 34552-84-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 54677972 |
| ChEMBL | CHEMBL1898455, CHEMBL53292 |
| ChEBI | CHEBI:76163 |
