MZR
5-hydroxy-1-(beta-D-ribofuranosyl)-1H-imidazole-4-carboxamide
Find entries where: MZR
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 5-hydroxy-1-(beta-D-ribofuranosyl)-1H-imidazole-4-carboxamide |
| Synonyms | Mizoribine |
| Identifiers | 1-[(2R,3R,4S,5R)-5-(hydroxymethyl)-3,4-bis(oxidanyl)oxolan-2-yl]-5-oxidanyl-imidazole-4-carboxamide |
| Formula | C9 H13 N3 O6 |
| Molecular Weight | 259.216 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1nc(c(n1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)N |
| InChI | InChI=1S/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | HZQDCMWJEBCWBR-UUOKFMHZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 31 |
| Chiral Atom Count | 4 |
| Bond Count | 32 |
| Aromatic Bond Count | 5 |
Drug Info: DrugBank
| DrugBank ID | DB12617 |
|---|---|
| Name | Mizoribine |
| Groups | investigational |
| Description | Mizoribine has been investigated for the treatment of Rheumatoid Arthritis. |
| Synonyms |
|
| Categories |
|
| CAS number | 50924-49-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 104762 |
| ChEMBL | CHEMBL245019 |
| ChEBI | CHEBI:31858 |
