Chemical Component Summary | |
|---|---|
| Name | Cerdulatinib |
| Synonyms | 4-(cyclopropylamino)-2-[[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]amino]pyrimidine-5-carboxamide |
| Identifiers | 4-(cyclopropylamino)-2-[[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]amino]pyrimidine-5-carboxamide |
| Formula | C20 H27 N7 O3 S |
| Molecular Weight | 445.538 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCS(=O)(=O)N1CCN(CC1)c2ccc(cc2)Nc3ncc(c(n3)NC4CC4)C(=O)N |
| InChI | InChI=1S/C20H27N7O3S/c1-2-31(29,30)27-11-9-26(10-12-27)16-7-5-15(6-8-16)24-20-22-13-17(18(21)28)19(25-20)23-14-3-4-14/h5-8,13-14H,2-4,9-12H2,1H3,(H2,21,28)(H2,22,23,24,25) |
| InChIKey | BGLPECHZZQDNCD-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 58 |
| Chiral Atom Count | 0 |
| Bond Count | 61 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB15499 |
|---|---|
| Name | Cerdulatinib |
| Groups | investigational |
| Description | Cerdulatinib is under investigation in clinical trial NCT04021082 (CELTIC-1: A Phase 2B Study of Cerdulatinib in Patients With Relapsed/refractory Peripheral T-cell Lymphoma (PTCL)). |
| Synonyms |
|
| Categories | Sulfur Compounds |
| CAS number | 1198300-79-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4116008 |
| PubChem | 44595079 |
| ChEMBL | CHEMBL4116008 |
