0M5: N-(4-chloro-3-fluorophenyl)-N'-{[(3R)-1-cyclopropylpyrrolidin-3-yl]methyl}ethanediamide
0M5 is a Ligand Of Interest in 4DVX designated by the RCSB
| Best-fitted instance in this entry |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
|---|
| 4DVX_0M5_A_512 | 74% | 5% | 0.099 | 0.928 | 2.27 | 2.96 | 11 | 10 | 1 | 0 | 100% | 1 |
| 4DVX_0M5_B_512 | 15% | 5% | 0.169 | 0.724 | 2.26 | 2.95 | 12 | 10 | 2 | 0 | 100% | 1 |
